About (1-acetylpiperidin-4-yl) thiocyanate
(1-acetylpiperidin-4-yl) thiocyanate (PubChem CID 143288798) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is (1-acetylpiperidin-4-yl) thiocyanate.
Molecular Properties
| Compound Name | (1-acetylpiperidin-4-yl) thiocyanate |
| PubChem CID | 143288798 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (1-acetylpiperidin-4-yl) thiocyanate |
| SMILES | CC(=O)N1CCC(SC#N)CC1 |
| InChI | InChI=1S/C8H12N2OS/c1-7(11)10-4-2-8(3-5-10)12-6-9/h8H,2-5H2,1H3 |
| InChIKey | UZOWWAMDSLBLMH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (1-acetylpiperidin-4-yl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetylpiperidin-4-yl) thiocyanate?
The IUPAC name of (1-acetylpiperidin-4-yl) thiocyanate (CID 143288798) is (1-acetylpiperidin-4-yl) thiocyanate.
What is the SMILES notation for (1-acetylpiperidin-4-yl) thiocyanate?
The canonical SMILES for (1-acetylpiperidin-4-yl) thiocyanate is CC(=O)N1CCC(SC#N)CC1.
What is the InChIKey of (1-acetylpiperidin-4-yl) thiocyanate?
The InChIKey is UZOWWAMDSLBLMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-7(11)10-4-2-8(3-5-10)12-6-9/h8H,2-5H2,1H3.
What are the key properties of (1-acetylpiperidin-4-yl) thiocyanate?
(1-acetylpiperidin-4-yl) thiocyanate has a molecular weight of 184.26 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetylpiperidin-4-yl) thiocyanate is sourced from PubChem (CID 143288798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).