C36H63N — CID 143289330
N-[(5R)-8-[(4-ethyl-3-hexylphenyl)methyl]-5,9-dimethyl-3-propan-2-yldec-1-en-2-yl]cyclohexanamine (PubChem CID 143289330) has the molecular formula C36H63N and a molecular weight of 509.91 g/mol. Its IUPAC name is N-[(5R)-8-[(4-ethyl-3-hexylphenyl)methyl]-5,9-dimethyl-3-propan-2-yldec-1-en-2-yl]cyclohexanamine.
| Compound Name | N-[(5R)-8-[(4-ethyl-3-hexylphenyl)methyl]-5,9-dimethyl-3-propan-2-yldec-1-en-2-yl]cyclohexanamine |
|---|---|
| PubChem CID | 143289330 |
| Molecular Formula | C36H63N |
| Molecular Weight | 509.91 g/mol |
| Exact Mass | 509.50 |
| IUPAC Name | N-[(5R)-8-[(4-ethyl-3-hexylphenyl)methyl]-5,9-dimethyl-3-propan-2-yldec-1-en-2-yl]cyclohexanamine |
| SMILES | C=C(NC1CCCCC1)C(C[C@H](C)CCC(Cc1ccc(CC)c(CCCCCC)c1)C(C)C)C(C)C |
| InChI | InChI=1S/C36H63N/c1-9-11-12-14-17-34-26-31(21-23-32(34)10-2)25-33(27(3)4)22-20-29(7)24-36(28(5)6)30(8)37-35-18-15-13-16-19-35/h21,23,26-29,33,35-37H,8-20,22,24-25H2,1-7H3/t29-,33?,36?/m1/s1 |
| InChIKey | WLDGWJLNNVDLPR-HLCCUOFJSA-N |
| XLogP | 10.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.91 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|