About 3,4-diiodo-5,6-dimethylpyridazine
3,4-diiodo-5,6-dimethylpyridazine (PubChem CID 143289460) has the molecular formula C6H6I2N2
and a molecular weight of 359.94 g/mol. Its IUPAC name is 3,4-diiodo-5,6-dimethylpyridazine.
Molecular Properties
| Compound Name | 3,4-diiodo-5,6-dimethylpyridazine |
| PubChem CID | 143289460 |
| Molecular Formula | C6H6I2N2 |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.86 |
| IUPAC Name | 3,4-diiodo-5,6-dimethylpyridazine |
| SMILES | Cc1nnc(I)c(I)c1C |
| InChI | InChI=1S/C6H6I2N2/c1-3-4(2)9-10-6(8)5(3)7/h1-2H3 |
| InChIKey | SNIIQEXPAQISLM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diiodo-5,6-dimethylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diiodo-5,6-dimethylpyridazine?
The IUPAC name of 3,4-diiodo-5,6-dimethylpyridazine (CID 143289460) is 3,4-diiodo-5,6-dimethylpyridazine.
What is the SMILES notation for 3,4-diiodo-5,6-dimethylpyridazine?
The canonical SMILES for 3,4-diiodo-5,6-dimethylpyridazine is Cc1nnc(I)c(I)c1C.
What is the InChIKey of 3,4-diiodo-5,6-dimethylpyridazine?
The InChIKey is SNIIQEXPAQISLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6I2N2/c1-3-4(2)9-10-6(8)5(3)7/h1-2H3.
What are the key properties of 3,4-diiodo-5,6-dimethylpyridazine?
3,4-diiodo-5,6-dimethylpyridazine has a molecular weight of 359.94 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diiodo-5,6-dimethylpyridazine is sourced from PubChem (CID 143289460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).