About (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone
(4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone (PubChem CID 143289914) has the molecular formula C22H22O3
and a molecular weight of 334.42 g/mol. Its IUPAC name is (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone.
Molecular Properties
| Compound Name | (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone |
| PubChem CID | 143289914 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1ccc(C(=O)c2ccc(C3C=CC=CC3)cc2)c(O)c1 |
| InChI | InChI=1S/C22H22O3/c1-15(2)25-19-12-13-20(21(23)14-19)22(24)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-6,8-16,23H,7H2,1-2H3 |
| InChIKey | VSBOEVQGQUXHQU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone?
The IUPAC name of (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone (CID 143289914) is (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone.
What is the SMILES notation for (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone?
The canonical SMILES for (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone is CC(C)Oc1ccc(C(=O)c2ccc(C3C=CC=CC3)cc2)c(O)c1.
What is the InChIKey of (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone?
The InChIKey is VSBOEVQGQUXHQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O3/c1-15(2)25-19-12-13-20(21(23)14-19)22(24)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-6,8-16,23H,7H2,1-2H3.
What are the key properties of (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone?
(4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone has a molecular weight of 334.42 g/mol, XLogP of 5.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclohexa-2,4-dien-1-ylphenyl)-(2-hydroxy-4-propan-2-yloxyphenyl)methanone is sourced from PubChem (CID 143289914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).