C17H15F2N5O3S — CID 143290163
4-[(2-amino-4-pyridinyl)methylamino]-N-[3-(difluoromethoxy)-4-hydroxyphenyl]-1,3-thiazole-5-carboxamide (PubChem CID 143290163) has the molecular formula C17H15F2N5O3S and a molecular weight of 407.40 g/mol. Its IUPAC name is 4-[(2-amino-4-pyridinyl)methylamino]-N-[3-(difluoromethoxy)-4-hydroxyphenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-[(2-amino-4-pyridinyl)methylamino]-N-[3-(difluoromethoxy)-4-hydroxyphenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 143290163 |
| Molecular Formula | C17H15F2N5O3S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 4-[(2-amino-4-pyridinyl)methylamino]-N-[3-(difluoromethoxy)-4-hydroxyphenyl]-1,3-thiazole-5-carboxamide |
| SMILES | Nc1cc(CNc2ncsc2C(=O)Nc2ccc(O)c(OC(F)F)c2)ccn1 |
| InChI | InChI=1S/C17H15F2N5O3S/c18-17(19)27-12-6-10(1-2-11(12)25)24-16(26)14-15(23-8-28-14)22-7-9-3-4-21-13(20)5-9/h1-6,8,17,22,25H,7H2,(H2,20,21)(H,24,26) |
| InChIKey | JLOHNCAXLCEAOZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|