C13H19N3O5 — CID 143290542
1-[2-[(5-oxooxolane-2-carbonyl)amino]propanoyl]pyrrolidine-2-carboxamide (PubChem CID 143290542) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-[2-[(5-oxooxolane-2-carbonyl)amino]propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[(5-oxooxolane-2-carbonyl)amino]propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143290542 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-[2-[(5-oxooxolane-2-carbonyl)amino]propanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(NC(=O)C1CCC(=O)O1)C(=O)N1CCCC1C(N)=O |
| InChI | InChI=1S/C13H19N3O5/c1-7(15-12(19)9-4-5-10(17)21-9)13(20)16-6-2-3-8(16)11(14)18/h7-9H,2-6H2,1H3,(H2,14,18)(H,15,19) |
| InChIKey | UWZCQEQLURPZJP-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |