C15H21F3N2O — CID 143291015
(2E,4E,6E)-2-methyl-7-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)hepta-2,4,6-trienamide (PubChem CID 143291015) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is (2E,4E,6E)-2-methyl-7-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)hepta-2,4,6-trienamide.
| Compound Name | (2E,4E,6E)-2-methyl-7-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 143291015 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (2E,4E,6E)-2-methyl-7-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)hepta-2,4,6-trienamide |
| SMILES | C/C(=C\C=C(/C=C/N1CCC(C)CC1)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C15H21F3N2O/c1-11-5-8-20(9-6-11)10-7-13(15(16,17)18)4-3-12(2)14(19)21/h3-4,7,10-11H,5-6,8-9H2,1-2H3,(H2,19,21)/b10-7+,12-3+,13-4+ |
| InChIKey | SFKNZPYFHXWFPI-HTOVRINOSA-N |
| XLogP | 3.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|