C24H34O3 — CID 143291113
(2'R,5R,16'S)-2',6',16'-trimethylspiro[oxolane-5,15'-tetracyclo[8.8.0.02,7.012,16]octadec-6-ene]-2,5'-dione (PubChem CID 143291113) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is (2'R,5R,16'S)-2',6',16'-trimethylspiro[oxolane-5,15'-tetracyclo[8.8.0.02,7.012,16]octadec-6-ene]-2,5'-dione.
| Compound Name | (2'R,5R,16'S)-2',6',16'-trimethylspiro[oxolane-5,15'-tetracyclo[8.8.0.02,7.012,16]octadec-6-ene]-2,5'-dione |
|---|---|
| PubChem CID | 143291113 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (2'R,5R,16'S)-2',6',16'-trimethylspiro[oxolane-5,15'-tetracyclo[8.8.0.02,7.012,16]octadec-6-ene]-2,5'-dione |
| SMILES | CC1=C2CCC3CC4CC[C@@]5(CCC(=O)O5)[C@@]4(C)CCC3[C@@]2(C)CCC1=O |
| InChI | InChI=1S/C24H34O3/c1-15-18-5-4-16-14-17-6-12-24(13-9-21(26)27-24)23(17,3)11-7-19(16)22(18,2)10-8-20(15)25/h16-17,19H,4-14H2,1-3H3/t16?,17?,19?,22-,23-,24+/m0/s1 |
| InChIKey | PZJPQXGUPBJWCA-ACDUEVOPSA-N |
| XLogP | 5.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |