C23H28N2O2S — CID 143291301
benzyl 7-methyl-4-(3-methylphenyl)-2-sulfanylidene-1,3,4,5-tetrahydro-1,3-diazepine-6-carboxylate;ethane (PubChem CID 143291301) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is benzyl 7-methyl-4-(3-methylphenyl)-2-sulfanylidene-1,3,4,5-tetrahydro-1,3-diazepine-6-carboxylate;ethane.
| Compound Name | benzyl 7-methyl-4-(3-methylphenyl)-2-sulfanylidene-1,3,4,5-tetrahydro-1,3-diazepine-6-carboxylate;ethane |
|---|---|
| PubChem CID | 143291301 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | benzyl 7-methyl-4-(3-methylphenyl)-2-sulfanylidene-1,3,4,5-tetrahydro-1,3-diazepine-6-carboxylate;ethane |
| SMILES | CC.CC1=C(C(=O)OCc2ccccc2)CC(c2cccc(C)c2)NC(=S)N1 |
| InChI | InChI=1S/C21H22N2O2S.C2H6/c1-14-7-6-10-17(11-14)19-12-18(15(2)22-21(26)23-19)20(24)25-13-16-8-4-3-5-9-16;1-2/h3-11,19H,12-13H2,1-2H3,(H2,22,23,26);1-2H3 |
| InChIKey | KVHOGIPWRLGKQH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|