C19H23BFNO4 — CID 143291706
2-[(4-fluorocyclohexa-1,5-dien-1-yl)amino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 143291706) has the molecular formula C19H23BFNO4 and a molecular weight of 359.21 g/mol. Its IUPAC name is 2-[(4-fluorocyclohexa-1,5-dien-1-yl)amino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 2-[(4-fluorocyclohexa-1,5-dien-1-yl)amino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 143291706 |
| Molecular Formula | C19H23BFNO4 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[(4-fluorocyclohexa-1,5-dien-1-yl)amino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CC1(C)OB(c2ccc(C(=O)O)c(NC3=CCC(F)C=C3)c2)OC1(C)C |
| InChI | InChI=1S/C19H23BFNO4/c1-18(2)19(3,4)26-20(25-18)12-5-10-15(17(23)24)16(11-12)22-14-8-6-13(21)7-9-14/h5-6,8-11,13,22H,7H2,1-4H3,(H,23,24) |
| InChIKey | XPNSVXWLTKTXQV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|