C28H46F2O2 — CID 143291793
ethane;1-ethenyl-4-[[(1Z,3Z)-4-[(4-ethenylcyclohexyl)methoxy]-2,3-difluorohexa-1,3,5-trienoxy]methyl]cyclohexane (PubChem CID 143291793) has the molecular formula C28H46F2O2 and a molecular weight of 452.67 g/mol. Its IUPAC name is ethane;1-ethenyl-4-[[(1Z,3Z)-4-[(4-ethenylcyclohexyl)methoxy]-2,3-difluorohexa-1,3,5-trienoxy]methyl]cyclohexane.
| Compound Name | ethane;1-ethenyl-4-[[(1Z,3Z)-4-[(4-ethenylcyclohexyl)methoxy]-2,3-difluorohexa-1,3,5-trienoxy]methyl]cyclohexane |
|---|---|
| PubChem CID | 143291793 |
| Molecular Formula | C28H46F2O2 |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | ethane;1-ethenyl-4-[[(1Z,3Z)-4-[(4-ethenylcyclohexyl)methoxy]-2,3-difluorohexa-1,3,5-trienoxy]methyl]cyclohexane |
| SMILES | C=C/C(OCC1CCC(C=C)CC1)=C(F)\C(F)=C\OCC1CCC(C=C)CC1.CC.CC |
| InChI | InChI=1S/C24H34F2O2.2C2H6/c1-4-18-7-11-20(12-8-18)15-27-17-22(25)24(26)23(6-3)28-16-21-13-9-19(5-2)10-14-21;2*1-2/h4-6,17-21H,1-3,7-16H2;2*1-2H3/b22-17-,24-23-;; |
| InChIKey | BNCPIPRQTRVLBY-MZVGEXKASA-N |
| XLogP | 9.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|