C11H16F2O2 — CID 143291854
2,2-difluoro-4,5-bis[(Z)-prop-1-enyl]-1,3-dioxole;ethane (PubChem CID 143291854) has the molecular formula C11H16F2O2 and a molecular weight of 218.24 g/mol. Its IUPAC name is 2,2-difluoro-4,5-bis[(Z)-prop-1-enyl]-1,3-dioxole;ethane.
| Compound Name | 2,2-difluoro-4,5-bis[(Z)-prop-1-enyl]-1,3-dioxole;ethane |
|---|---|
| PubChem CID | 143291854 |
| Molecular Formula | C11H16F2O2 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2,2-difluoro-4,5-bis[(Z)-prop-1-enyl]-1,3-dioxole;ethane |
| SMILES | C/C=C\C1=C(/C=C\C)OC(F)(F)O1.CC |
| InChI | InChI=1S/C9H10F2O2.C2H6/c1-3-5-7-8(6-4-2)13-9(10,11)12-7;1-2/h3-6H,1-2H3;1-2H3/b5-3-,6-4-; |
| InChIKey | YCZWTDWGKXTEBD-VIOUERSGSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |