C16H23N3OS — CID 143292761
1-[(7-tert-butyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinolin-2-yl)amino]ethanol (PubChem CID 143292761) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 1-[(7-tert-butyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinolin-2-yl)amino]ethanol.
| Compound Name | 1-[(7-tert-butyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinolin-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 143292761 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1-[(7-tert-butyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinolin-2-yl)amino]ethanol |
| SMILES | CC(O)Nc1nc2cc3c(nc2s1)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C16H23N3OS/c1-9(20)17-15-19-13-8-10-7-11(16(2,3)4)5-6-12(10)18-14(13)21-15/h8-9,11,20H,5-7H2,1-4H3,(H,17,19) |
| InChIKey | IYGAIBXEDCURGQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|