C18H28N2O2S — CID 143292828
ethane;N-methylhydroxylamine;6-propan-2-yl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbaldehyde (PubChem CID 143292828) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is ethane;N-methylhydroxylamine;6-propan-2-yl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbaldehyde.
| Compound Name | ethane;N-methylhydroxylamine;6-propan-2-yl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 143292828 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | ethane;N-methylhydroxylamine;6-propan-2-yl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbaldehyde |
| SMILES | CC.CC(C)C1CCc2nc3sc(C=O)cc3cc2C1.CNO |
| InChI | InChI=1S/C15H17NOS.C2H6.CH5NO/c1-9(2)10-3-4-14-11(5-10)6-12-7-13(8-17)18-15(12)16-14;1-2;1-2-3/h6-10H,3-5H2,1-2H3;1-2H3;2-3H,1H3 |
| InChIKey | NFWLSJSFEAJLRL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|