C11H18O2 — CID 143292981
1-(4-hydroxy-1,2,2-trimethylcyclopentyl)prop-2-en-1-one (PubChem CID 143292981) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 1-(4-hydroxy-1,2,2-trimethylcyclopentyl)prop-2-en-1-one.
| Compound Name | 1-(4-hydroxy-1,2,2-trimethylcyclopentyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 143292981 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-(4-hydroxy-1,2,2-trimethylcyclopentyl)prop-2-en-1-one |
| SMILES | C=CC(=O)C1(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C11H18O2/c1-5-9(13)11(4)7-8(12)6-10(11,2)3/h5,8,12H,1,6-7H2,2-4H3 |
| InChIKey | DWHODQVKIDLZDH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|