About oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate
oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate (PubChem CID 143293362) has the molecular formula C23H25N5O4
and a molecular weight of 435.48 g/mol. Its IUPAC name is oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate.
Molecular Properties
| Compound Name | oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate |
| PubChem CID | 143293362 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate |
| SMILES | Cc1c(N)cccc1-c1cn(C)c(=O)c(Nc2cccc(NC(=O)OC3CCOC3)c2)n1 |
| InChI | InChI=1S/C23H25N5O4/c1-14-18(7-4-8-19(14)24)20-12-28(2)22(29)21(27-20)25-15-5-3-6-16(11-15)26-23(30)32-17-9-10-31-13-17/h3-8,11-12,17H,9-10,13,24H2,1-2H3,(H,25,27)(H,26,30) |
| InChIKey | ZHURJVMSTGVBKG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate?
The IUPAC name of oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate (CID 143293362) is oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate.
What is the SMILES notation for oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate?
The canonical SMILES for oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate is Cc1c(N)cccc1-c1cn(C)c(=O)c(Nc2cccc(NC(=O)OC3CCOC3)c2)n1.
What is the InChIKey of oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate?
The InChIKey is ZHURJVMSTGVBKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N5O4/c1-14-18(7-4-8-19(14)24)20-12-28(2)22(29)21(27-20)25-15-5-3-6-16(11-15)26-23(30)32-17-9-10-31-13-17/h3-8,11-12,17H,9-10,13,24H2,1-2H3,(H,25,27)(H,26,30).
What are the key properties of oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate?
oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate has a molecular weight of 435.48 g/mol, XLogP of 3.42, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]carbamate is sourced from PubChem (CID 143293362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).