About 3,4-dimethyl-1H-indole;ethane
3,4-dimethyl-1H-indole;ethane (PubChem CID 143293593) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 3,4-dimethyl-1H-indole;ethane.
Molecular Properties
| Compound Name | 3,4-dimethyl-1H-indole;ethane |
| PubChem CID | 143293593 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 3,4-dimethyl-1H-indole;ethane |
| SMILES | CC.Cc1cccc2[nH]cc(C)c12 |
| InChI | InChI=1S/C10H11N.C2H6/c1-7-4-3-5-9-10(7)8(2)6-11-9;1-2/h3-6,11H,1-2H3;1-2H3 |
| InChIKey | GIMGNFQCVPPWSP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,4-dimethyl-1H-indole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1H-indole;ethane?
The IUPAC name of 3,4-dimethyl-1H-indole;ethane (CID 143293593) is 3,4-dimethyl-1H-indole;ethane.
What is the SMILES notation for 3,4-dimethyl-1H-indole;ethane?
The canonical SMILES for 3,4-dimethyl-1H-indole;ethane is CC.Cc1cccc2[nH]cc(C)c12.
What is the InChIKey of 3,4-dimethyl-1H-indole;ethane?
The InChIKey is GIMGNFQCVPPWSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C2H6/c1-7-4-3-5-9-10(7)8(2)6-11-9;1-2/h3-6,11H,1-2H3;1-2H3.
What are the key properties of 3,4-dimethyl-1H-indole;ethane?
3,4-dimethyl-1H-indole;ethane has a molecular weight of 175.27 g/mol, XLogP of 3.81, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1H-indole;ethane is sourced from PubChem (CID 143293593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).