C15H24F2N2O — CID 143293755
N-[(3S,5Z,6E,8E)-5-ethylidene-7,9-difluoro-1-(propylamino)nona-6,8-dien-3-yl]formamide (PubChem CID 143293755) has the molecular formula C15H24F2N2O and a molecular weight of 286.37 g/mol. Its IUPAC name is N-[(3S,5Z,6E,8E)-5-ethylidene-7,9-difluoro-1-(propylamino)nona-6,8-dien-3-yl]formamide.
| Compound Name | N-[(3S,5Z,6E,8E)-5-ethylidene-7,9-difluoro-1-(propylamino)nona-6,8-dien-3-yl]formamide |
|---|---|
| PubChem CID | 143293755 |
| Molecular Formula | C15H24F2N2O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-[(3S,5Z,6E,8E)-5-ethylidene-7,9-difluoro-1-(propylamino)nona-6,8-dien-3-yl]formamide |
| SMILES | C/C=C(\C=C(F)/C=C/F)C[C@@H](CCNCCC)NC=O |
| InChI | InChI=1S/C15H24F2N2O/c1-3-8-18-9-6-15(19-12-20)11-13(4-2)10-14(17)5-7-16/h4-5,7,10,12,15,18H,3,6,8-9,11H2,1-2H3,(H,19,20)/b7-5+,13-4+,14-10+/t15-/m1/s1 |
| InChIKey | JUARPLWCTCTPDZ-AJHGLHBUSA-N |
| XLogP | 3.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|