C29H26N4O3 — CID 143293872
methyl 3-but-1-en-2-yl-2-[1-(isoquinoline-3-carbonylamino)ethylideneamino]-5-pyridin-4-ylbenzoate (PubChem CID 143293872) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is methyl 3-but-1-en-2-yl-2-[1-(isoquinoline-3-carbonylamino)ethylideneamino]-5-pyridin-4-ylbenzoate.
| Compound Name | methyl 3-but-1-en-2-yl-2-[1-(isoquinoline-3-carbonylamino)ethylideneamino]-5-pyridin-4-ylbenzoate |
|---|---|
| PubChem CID | 143293872 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | methyl 3-but-1-en-2-yl-2-[1-(isoquinoline-3-carbonylamino)ethylideneamino]-5-pyridin-4-ylbenzoate |
| SMILES | C=C(CC)c1cc(-c2ccncc2)cc(C(=O)OC)c1/N=C(\C)NC(=O)c1cc2ccccc2cn1 |
| InChI | InChI=1S/C29H26N4O3/c1-5-18(2)24-14-23(20-10-12-30-13-11-20)15-25(29(35)36-4)27(24)32-19(3)33-28(34)26-16-21-8-6-7-9-22(21)17-31-26/h6-17H,2,5H2,1,3-4H3,(H,32,33,34) |
| InChIKey | LPOHDWZKUODXDU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|