C22H34N4 — CID 143294261
(2Z,4Z)-N,N-dimethyl-3-(2-methylcyclohepta-1,3,6-trien-1-yl)-5-(4-methyl-1,4-diazepan-1-yl)-5-(methylideneamino)penta-2,4-dien-2-amine (PubChem CID 143294261) has the molecular formula C22H34N4 and a molecular weight of 354.54 g/mol. Its IUPAC name is (2Z,4Z)-N,N-dimethyl-3-(2-methylcyclohepta-1,3,6-trien-1-yl)-5-(4-methyl-1,4-diazepan-1-yl)-5-(methylideneamino)penta-2,4-dien-2-amine.
| Compound Name | (2Z,4Z)-N,N-dimethyl-3-(2-methylcyclohepta-1,3,6-trien-1-yl)-5-(4-methyl-1,4-diazepan-1-yl)-5-(methylideneamino)penta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 143294261 |
| Molecular Formula | C22H34N4 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (2Z,4Z)-N,N-dimethyl-3-(2-methylcyclohepta-1,3,6-trien-1-yl)-5-(4-methyl-1,4-diazepan-1-yl)-5-(methylideneamino)penta-2,4-dien-2-amine |
| SMILES | C=N/C(=C\C(C1=C(C)C=CCC=C1)=C(/C)N(C)C)N1CCCN(C)CC1 |
| InChI | InChI=1S/C22H34N4/c1-18-11-8-7-9-12-20(18)21(19(2)24(4)5)17-22(23-3)26-14-10-13-25(6)15-16-26/h8-9,11-12,17H,3,7,10,13-16H2,1-2,4-6H3/b21-19-,22-17+ |
| InChIKey | CMJQWUQHVCMOHT-BHOZXSGLSA-N |
| XLogP | 3.83 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|