About 5-bromo-2-chloropyrimidin-4-amine;oxolane
5-bromo-2-chloropyrimidin-4-amine;oxolane (PubChem CID 143294282) has the molecular formula C8H11BrClN3O
and a molecular weight of 280.55 g/mol. Its IUPAC name is 5-bromo-2-chloropyrimidin-4-amine;oxolane.
Molecular Properties
| Compound Name | 5-bromo-2-chloropyrimidin-4-amine;oxolane |
| PubChem CID | 143294282 |
| Molecular Formula | C8H11BrClN3O |
| Molecular Weight | 280.55 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 5-bromo-2-chloropyrimidin-4-amine;oxolane |
| SMILES | C1CCOC1.Nc1nc(Cl)ncc1Br |
| InChI | InChI=1S/C4H3BrClN3.C4H8O/c5-2-1-8-4(6)9-3(2)7;1-2-4-5-3-1/h1H,(H2,7,8,9);1-4H2 |
| InChIKey | QMJUGFWDLUMBBD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.55 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-chloropyrimidin-4-amine;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-chloropyrimidin-4-amine;oxolane?
The IUPAC name of 5-bromo-2-chloropyrimidin-4-amine;oxolane (CID 143294282) is 5-bromo-2-chloropyrimidin-4-amine;oxolane.
What is the SMILES notation for 5-bromo-2-chloropyrimidin-4-amine;oxolane?
The canonical SMILES for 5-bromo-2-chloropyrimidin-4-amine;oxolane is C1CCOC1.Nc1nc(Cl)ncc1Br.
What is the InChIKey of 5-bromo-2-chloropyrimidin-4-amine;oxolane?
The InChIKey is QMJUGFWDLUMBBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3BrClN3.C4H8O/c5-2-1-8-4(6)9-3(2)7;1-2-4-5-3-1/h1H,(H2,7,8,9);1-4H2.
What are the key properties of 5-bromo-2-chloropyrimidin-4-amine;oxolane?
5-bromo-2-chloropyrimidin-4-amine;oxolane has a molecular weight of 280.55 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-chloropyrimidin-4-amine;oxolane is sourced from PubChem (CID 143294282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).