C18H18N2O4 — CID 143294284
1-[(3E,5Z)-7-(2,5-dioxopyrrol-1-yl)nona-3,5,8-trien-4-yl]-3-methylidenepyrrolidine-2,5-dione (PubChem CID 143294284) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 1-[(3E,5Z)-7-(2,5-dioxopyrrol-1-yl)nona-3,5,8-trien-4-yl]-3-methylidenepyrrolidine-2,5-dione.
| Compound Name | 1-[(3E,5Z)-7-(2,5-dioxopyrrol-1-yl)nona-3,5,8-trien-4-yl]-3-methylidenepyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 143294284 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-[(3E,5Z)-7-(2,5-dioxopyrrol-1-yl)nona-3,5,8-trien-4-yl]-3-methylidenepyrrolidine-2,5-dione |
| SMILES | C=CC(/C=C\C(=C/CC)N1C(=O)CC(=C)C1=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H18N2O4/c1-4-6-14(20-17(23)11-12(3)18(20)24)8-7-13(5-2)19-15(21)9-10-16(19)22/h5-10,13H,2-4,11H2,1H3/b8-7+,14-6+ |
| InChIKey | KLYXMDZDKNCLON-QNNKSKBKSA-N |
| XLogP | 1.63 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|