C11H14N2 — CID 143294948
ethane;6H-pyrido[2,3-b]azepine (PubChem CID 143294948) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is ethane;6H-pyrido[2,3-b]azepine.
| Compound Name | ethane;6H-pyrido[2,3-b]azepine |
|---|---|
| PubChem CID | 143294948 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | ethane;6H-pyrido[2,3-b]azepine |
| SMILES | C1=CN=c2ncccc2=CC1.CC |
| InChI | InChI=1S/C9H8N2.C2H6/c1-2-6-10-9-8(4-1)5-3-7-11-9;1-2/h2-7H,1H2;1-2H3 |
| InChIKey | PYFCJECHLGFFII-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |