C11H10N2O4 — CID 143295220
3-[2-(2,5-dioxopyrrol-3-yl)propan-2-yl]pyrrole-2,5-dione (PubChem CID 143295220) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-[2-(2,5-dioxopyrrol-3-yl)propan-2-yl]pyrrole-2,5-dione.
| Compound Name | 3-[2-(2,5-dioxopyrrol-3-yl)propan-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 143295220 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-[2-(2,5-dioxopyrrol-3-yl)propan-2-yl]pyrrole-2,5-dione |
| SMILES | CC(C)(C1=CC(=O)NC1=O)C1=CC(=O)NC1=O |
| InChI | InChI=1S/C11H10N2O4/c1-11(2,5-3-7(14)12-9(5)16)6-4-8(15)13-10(6)17/h3-4H,1-2H3,(H,12,14,16)(H,13,15,17) |
| InChIKey | NLWBUHPQVXVOCP-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|