C23H27N5O3S2 — CID 143295685
ethane;methyl 2-[4-[2-[(3-cyanobenzoyl)amino]ethylamino]-6-ethylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetate (PubChem CID 143295685) has the molecular formula C23H27N5O3S2 and a molecular weight of 485.64 g/mol. Its IUPAC name is ethane;methyl 2-[4-[2-[(3-cyanobenzoyl)amino]ethylamino]-6-ethylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetate.
| Compound Name | ethane;methyl 2-[4-[2-[(3-cyanobenzoyl)amino]ethylamino]-6-ethylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 143295685 |
| Molecular Formula | C23H27N5O3S2 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | ethane;methyl 2-[4-[2-[(3-cyanobenzoyl)amino]ethylamino]-6-ethylthieno[2,3-d]pyrimidin-2-yl]sulfanylacetate |
| SMILES | CC.CCc1cc2c(NCCNC(=O)c3cccc(C#N)c3)nc(SCC(=O)OC)nc2s1 |
| InChI | InChI=1S/C21H21N5O3S2.C2H6/c1-3-15-10-16-18(25-21(26-20(16)31-15)30-12-17(27)29-2)23-7-8-24-19(28)14-6-4-5-13(9-14)11-22;1-2/h4-6,9-10H,3,7-8,12H2,1-2H3,(H,24,28)(H,23,25,26);1-2H3 |
| InChIKey | WSMMMNTZBFOCOH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|