About (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine
(Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine (PubChem CID 143295815) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine.
Molecular Properties
| Compound Name | (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine |
| PubChem CID | 143295815 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine |
| SMILES | CCc1[nH]c2c(c1/C=C\NC)=CC=NCC=2 |
| InChI | InChI=1S/C13H17N3/c1-3-12-10(4-7-14-2)11-5-8-15-9-6-13(11)16-12/h4-8,14,16H,3,9H2,1-2H3/b7-4- |
| InChIKey | STKWDHSSXWORBZ-DAXSKMNVSA-N |
| XLogP | 0.41 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine?
The IUPAC name of (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine (CID 143295815) is (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine.
What is the SMILES notation for (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine?
The canonical SMILES for (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine is CCc1[nH]c2c(c1/C=C\NC)=CC=NCC=2.
What is the InChIKey of (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine?
The InChIKey is STKWDHSSXWORBZ-DAXSKMNVSA-N. The full InChI is InChI=1S/C13H17N3/c1-3-12-10(4-7-14-2)11-5-8-15-9-6-13(11)16-12/h4-8,14,16H,3,9H2,1-2H3/b7-4-.
What are the key properties of (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine?
(Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine has a molecular weight of 215.30 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2-ethyl-1,7-dihydropyrrolo[2,3-d]azepin-3-yl)-N-methylethenamine is sourced from PubChem (CID 143295815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).