About acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine
acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine (PubChem CID 143295854) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine.
Molecular Properties
| Compound Name | acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine |
| PubChem CID | 143295854 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine |
| SMILES | C#C.C/C=C1/C2=C(N=CC=CC2)N(C)/C1=N\C |
| InChI | InChI=1S/C12H15N3.C2H2/c1-4-9-10-7-5-6-8-14-12(10)15(3)11(9)13-2;1-2/h4-6,8H,7H2,1-3H3;1-2H/b9-4-,13-11-; |
| InChIKey | UXOCOXBGVBCFRG-OUZPYMNFSA-N |
| XLogP | 2.40 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine?
The IUPAC name of acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine (CID 143295854) is acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine.
What is the SMILES notation for acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine?
The canonical SMILES for acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine is C#C.C/C=C1/C2=C(N=CC=CC2)N(C)/C1=N\C.
What is the InChIKey of acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine?
The InChIKey is UXOCOXBGVBCFRG-OUZPYMNFSA-N. The full InChI is InChI=1S/C12H15N3.C2H2/c1-4-9-10-7-5-6-8-14-12(10)15(3)11(9)13-2;1-2/h4-6,8H,7H2,1-3H3;1-2H/b9-4-,13-11-;.
What are the key properties of acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine?
acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine has a molecular weight of 227.31 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(3Z)-3-ethylidene-N,1-dimethyl-4H-pyrrolo[2,3-b]azepin-2-imine is sourced from PubChem (CID 143295854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).