C41H52N2 — CID 143296033
ethane;4-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-N,4-N-diphenyl-1-N-[4-(2,5,5-trimethylhexan-3-yl)phenyl]benzene-1,4-diamine (PubChem CID 143296033) has the molecular formula C41H52N2 and a molecular weight of 572.88 g/mol. Its IUPAC name is ethane;4-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-N,4-N-diphenyl-1-N-[4-(2,5,5-trimethylhexan-3-yl)phenyl]benzene-1,4-diamine.
| Compound Name | ethane;4-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-N,4-N-diphenyl-1-N-[4-(2,5,5-trimethylhexan-3-yl)phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 143296033 |
| Molecular Formula | C41H52N2 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | ethane;4-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-N,4-N-diphenyl-1-N-[4-(2,5,5-trimethylhexan-3-yl)phenyl]benzene-1,4-diamine |
| SMILES | C/C=C\C(=C/C)N(c1ccccc1)c1ccc(N(c2ccccc2)c2ccc(C(CC(C)(C)C)C(C)C)cc2)cc1.CC |
| InChI | InChI=1S/C39H46N2.C2H6/c1-8-16-32(9-2)40(33-17-12-10-13-18-33)36-25-27-37(28-26-36)41(34-19-14-11-15-20-34)35-23-21-31(22-24-35)38(30(3)4)29-39(5,6)7;1-2/h8-28,30,38H,29H2,1-7H3;1-2H3/b16-8-,32-9+; |
| InChIKey | LFUMQJFEUJDNCQ-IMDNVVBLSA-N |
| XLogP | 12.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|