About 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol
5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol (PubChem CID 143297210) has the molecular formula C13H17N3O3
and a molecular weight of 263.30 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol.
Molecular Properties
| Compound Name | 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol |
| PubChem CID | 143297210 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol |
| SMILES | C=Cc1ncc(C(=O)N(C)CC=O)nc1C=C.CO |
| InChI | InChI=1S/C12H13N3O2.CH4O/c1-4-9-10(5-2)14-11(8-13-9)12(17)15(3)6-7-16;1-2/h4-5,7-8H,1-2,6H2,3H3;2H,1H3 |
| InChIKey | LECHAJOTEROCEU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol?
The IUPAC name of 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol (CID 143297210) is 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol.
What is the SMILES notation for 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol?
The canonical SMILES for 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol is C=Cc1ncc(C(=O)N(C)CC=O)nc1C=C.CO.
What is the InChIKey of 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol?
The InChIKey is LECHAJOTEROCEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2.CH4O/c1-4-9-10(5-2)14-11(8-13-9)12(17)15(3)6-7-16;1-2/h4-5,7-8H,1-2,6H2,3H3;2H,1H3.
What are the key properties of 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol?
5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol has a molecular weight of 263.30 g/mol, XLogP of 0.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(ethenyl)-N-methyl-N-(2-oxoethyl)pyrazine-2-carboxamide;methanol is sourced from PubChem (CID 143297210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).