About methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate
methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate (PubChem CID 14329793) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate |
| PubChem CID | 14329793 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate |
| SMILES | C/C=C(/C=C/C(=O)NCC(=O)OC)CC |
| InChI | InChI=1S/C11H17NO3/c1-4-9(5-2)6-7-10(13)12-8-11(14)15-3/h4,6-7H,5,8H2,1-3H3,(H,12,13)/b7-6+,9-4+ |
| InChIKey | NRPBCVCQXAHSJK-PIAAQLDDSA-N |
| XLogP | 1.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate?
The IUPAC name of methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate (CID 14329793) is methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate.
What is the SMILES notation for methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate?
The canonical SMILES for methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate is C/C=C(/C=C/C(=O)NCC(=O)OC)CC.
What is the InChIKey of methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate?
The InChIKey is NRPBCVCQXAHSJK-PIAAQLDDSA-N. The full InChI is InChI=1S/C11H17NO3/c1-4-9(5-2)6-7-10(13)12-8-11(14)15-3/h4,6-7H,5,8H2,1-3H3,(H,12,13)/b7-6+,9-4+.
What are the key properties of methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate?
methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate has a molecular weight of 211.26 g/mol, XLogP of 1.19, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2E,4E)-4-ethylhexa-2,4-dienoyl]amino]acetate is sourced from PubChem (CID 14329793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).