About (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol
(3E,5E)-6-methoxyhepta-3,5-diene-3-thiol (PubChem CID 143298078) has the molecular formula C8H14OS
and a molecular weight of 158.27 g/mol. Its IUPAC name is (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol.
Molecular Properties
| Compound Name | (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol |
| PubChem CID | 143298078 |
| Molecular Formula | C8H14OS |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol |
| SMILES | CC/C(S)=C\C=C(/C)OC |
| InChI | InChI=1S/C8H14OS/c1-4-8(10)6-5-7(2)9-3/h5-6,10H,4H2,1-3H3/b7-5+,8-6+ |
| InChIKey | NZDNUXICFRUDST-KQQUZDAGSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol?
The IUPAC name of (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol (CID 143298078) is (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol.
What is the SMILES notation for (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol?
The canonical SMILES for (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol is CC/C(S)=C\C=C(/C)OC.
What is the InChIKey of (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol?
The InChIKey is NZDNUXICFRUDST-KQQUZDAGSA-N. The full InChI is InChI=1S/C8H14OS/c1-4-8(10)6-5-7(2)9-3/h5-6,10H,4H2,1-3H3/b7-5+,8-6+.
What are the key properties of (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol?
(3E,5E)-6-methoxyhepta-3,5-diene-3-thiol has a molecular weight of 158.27 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-6-methoxyhepta-3,5-diene-3-thiol is sourced from PubChem (CID 143298078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).