C36H46N4O4 — CID 143298358
(2S)-5-(4-cyclohexylpiperazin-1-yl)-2-[2-ethenyl-4-methylidene-3-(2-oxo-4-phenyl-1,3-oxazetidin-3-yl)azetidin-1-yl]-5-oxopentanal;toluene (PubChem CID 143298358) has the molecular formula C36H46N4O4 and a molecular weight of 598.79 g/mol. Its IUPAC name is (2S)-5-(4-cyclohexylpiperazin-1-yl)-2-[2-ethenyl-4-methylidene-3-(2-oxo-4-phenyl-1,3-oxazetidin-3-yl)azetidin-1-yl]-5-oxopentanal;toluene.
| Compound Name | (2S)-5-(4-cyclohexylpiperazin-1-yl)-2-[2-ethenyl-4-methylidene-3-(2-oxo-4-phenyl-1,3-oxazetidin-3-yl)azetidin-1-yl]-5-oxopentanal;toluene |
|---|---|
| PubChem CID | 143298358 |
| Molecular Formula | C36H46N4O4 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | (2S)-5-(4-cyclohexylpiperazin-1-yl)-2-[2-ethenyl-4-methylidene-3-(2-oxo-4-phenyl-1,3-oxazetidin-3-yl)azetidin-1-yl]-5-oxopentanal;toluene |
| SMILES | C=CC1C(N2C(=O)OC2c2ccccc2)C(=C)N1[C@H](C=O)CCC(=O)N1CCN(C2CCCCC2)CC1.Cc1ccccc1 |
| InChI | InChI=1S/C29H38N4O4.C7H8/c1-3-25-27(33-28(37-29(33)36)22-10-6-4-7-11-22)21(2)32(25)24(20-34)14-15-26(35)31-18-16-30(17-19-31)23-12-8-5-9-13-23;1-7-5-3-2-4-6-7/h3-4,6-7,10-11,20,23-25,27-28H,1-2,5,8-9,12-19H2;2-6H,1H3/t24-,25?,27?,28?;/m0./s1 |
| InChIKey | HFGFHVVCCKGJQQ-FJZMHIOPSA-N |
| XLogP | 5.71 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|