C18H18ClF3O3 — CID 143298421
2-[(1E,6Z)-5-chlorocycloocta-1,6-dien-1-yl]-2-[3-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxyacetic acid (PubChem CID 143298421) has the molecular formula C18H18ClF3O3 and a molecular weight of 374.79 g/mol. Its IUPAC name is 2-[(1E,6Z)-5-chlorocycloocta-1,6-dien-1-yl]-2-[3-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxyacetic acid.
| Compound Name | 2-[(1E,6Z)-5-chlorocycloocta-1,6-dien-1-yl]-2-[3-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 143298421 |
| Molecular Formula | C18H18ClF3O3 |
| Molecular Weight | 374.79 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-[(1E,6Z)-5-chlorocycloocta-1,6-dien-1-yl]-2-[3-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]oxyacetic acid |
| SMILES | O=C(O)C(OC1=CC(C(F)(F)F)=CCC=C1)/C1=C/CCC(Cl)/C=C\C1 |
| InChI | InChI=1S/C18H18ClF3O3/c19-14-8-3-5-12(6-4-9-14)16(17(23)24)25-15-10-2-1-7-13(11-15)18(20,21)22/h2-3,6-8,10-11,14,16H,1,4-5,9H2,(H,23,24)/b8-3-,12-6+ |
| InChIKey | OFWMRRGOPFIYBK-NSRAGWQASA-N |
| XLogP | 5.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.79 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|