C23H22FNO4S — CID 143298928
4-[4-[3-(4-fluorophenyl)propyl]-1,1-dioxo-2-phenylthiazetidin-3-yl]benzene-1,3-diol (PubChem CID 143298928) has the molecular formula C23H22FNO4S and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-[4-[3-(4-fluorophenyl)propyl]-1,1-dioxo-2-phenylthiazetidin-3-yl]benzene-1,3-diol.
| Compound Name | 4-[4-[3-(4-fluorophenyl)propyl]-1,1-dioxo-2-phenylthiazetidin-3-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 143298928 |
| Molecular Formula | C23H22FNO4S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 4-[4-[3-(4-fluorophenyl)propyl]-1,1-dioxo-2-phenylthiazetidin-3-yl]benzene-1,3-diol |
| SMILES | O=S1(=O)C(CCCc2ccc(F)cc2)C(c2ccc(O)cc2O)N1c1ccccc1 |
| InChI | InChI=1S/C23H22FNO4S/c24-17-11-9-16(10-12-17)5-4-8-22-23(20-14-13-19(26)15-21(20)27)25(30(22,28)29)18-6-2-1-3-7-18/h1-3,6-7,9-15,22-23,26-27H,4-5,8H2 |
| InChIKey | XEWQJZJCYFLXJN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|