C12H16N2O — CID 143299235
N-(3,4-dihydroquinolin-8-yl)formamide;ethane (PubChem CID 143299235) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-(3,4-dihydroquinolin-8-yl)formamide;ethane.
| Compound Name | N-(3,4-dihydroquinolin-8-yl)formamide;ethane |
|---|---|
| PubChem CID | 143299235 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-(3,4-dihydroquinolin-8-yl)formamide;ethane |
| SMILES | CC.O=CNc1cccc2c1N=CCC2 |
| InChI | InChI=1S/C10H10N2O.C2H6/c13-7-12-9-5-1-3-8-4-2-6-11-10(8)9;1-2/h1,3,5-7H,2,4H2,(H,12,13);1-2H3 |
| InChIKey | FJURXAHABGIVQD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|