About 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide
2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide (PubChem CID 143299298) has the molecular formula C16H24FNO2
and a molecular weight of 281.37 g/mol. Its IUPAC name is 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide.
Molecular Properties
| Compound Name | 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide |
| PubChem CID | 143299298 |
| Molecular Formula | C16H24FNO2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide |
| SMILES | C=CCCCCCNC(=O)COCC1=CCC(F)C=C1 |
| InChI | InChI=1S/C16H24FNO2/c1-2-3-4-5-6-11-18-16(19)13-20-12-14-7-9-15(17)10-8-14/h2,7-9,15H,1,3-6,10-13H2,(H,18,19) |
| InChIKey | BJHUYNVTABQHME-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide?
The IUPAC name of 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide (CID 143299298) is 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide.
What is the SMILES notation for 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide?
The canonical SMILES for 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide is C=CCCCCCNC(=O)COCC1=CCC(F)C=C1.
What is the InChIKey of 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide?
The InChIKey is BJHUYNVTABQHME-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24FNO2/c1-2-3-4-5-6-11-18-16(19)13-20-12-14-7-9-15(17)10-8-14/h2,7-9,15H,1,3-6,10-13H2,(H,18,19).
What are the key properties of 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide?
2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide has a molecular weight of 281.37 g/mol, XLogP of 3.09, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorocyclohexa-1,5-dien-1-yl)methoxy]-N-hept-6-enylacetamide is sourced from PubChem (CID 143299298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).