C27H40FN3O5 — CID 143299317
2-acetamido-N-(2-methoxyphenyl)acetamide;N-butyl-2-[(4-fluorophenyl)methoxy]acetamide;propane (PubChem CID 143299317) has the molecular formula C27H40FN3O5 and a molecular weight of 505.63 g/mol. Its IUPAC name is 2-acetamido-N-(2-methoxyphenyl)acetamide;N-butyl-2-[(4-fluorophenyl)methoxy]acetamide;propane.
| Compound Name | 2-acetamido-N-(2-methoxyphenyl)acetamide;N-butyl-2-[(4-fluorophenyl)methoxy]acetamide;propane |
|---|---|
| PubChem CID | 143299317 |
| Molecular Formula | C27H40FN3O5 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 2-acetamido-N-(2-methoxyphenyl)acetamide;N-butyl-2-[(4-fluorophenyl)methoxy]acetamide;propane |
| SMILES | CCC.CCCCNC(=O)COCc1ccc(F)cc1.COc1ccccc1NC(=O)CNC(C)=O |
| InChI | InChI=1S/C13H18FNO2.C11H14N2O3.C3H8/c1-2-3-8-15-13(16)10-17-9-11-4-6-12(14)7-5-11;1-8(14)12-7-11(15)13-9-5-3-4-6-10(9)16-2;1-3-2/h4-7H,2-3,8-10H2,1H3,(H,15,16);3-6H,7H2,1-2H3,(H,12,14)(H,13,15);3H2,1-2H3 |
| InChIKey | IAOAMXRITXNEKH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|