C26H33FN2S2 — CID 143299331
1-(4-fluorophenyl)sulfanyl-N-[5-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-thiazol-4-yl]pentyl]pent-2-en-2-amine (PubChem CID 143299331) has the molecular formula C26H33FN2S2 and a molecular weight of 456.70 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfanyl-N-[5-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-thiazol-4-yl]pentyl]pent-2-en-2-amine.
| Compound Name | 1-(4-fluorophenyl)sulfanyl-N-[5-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-thiazol-4-yl]pentyl]pent-2-en-2-amine |
|---|---|
| PubChem CID | 143299331 |
| Molecular Formula | C26H33FN2S2 |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 1-(4-fluorophenyl)sulfanyl-N-[5-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,3-thiazol-4-yl]pentyl]pent-2-en-2-amine |
| SMILES | C=C/C(=C\C=C/C)c1nc(CCCCCNC(=CCC)CSc2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C26H33FN2S2/c1-4-7-12-21(6-3)26-29-24(20-31-26)13-9-8-10-18-28-23(11-5-2)19-30-25-16-14-22(27)15-17-25/h4,6-7,11-12,14-17,20,28H,3,5,8-10,13,18-19H2,1-2H3/b7-4-,21-12+,23-11? |
| InChIKey | OQSBTCYQDAYZSZ-UTDFLHEOSA-N |
| XLogP | 7.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|