C19H23FN2O4S — CID 143299424
2-[(4-fluorophenyl)methoxy]-N-[3-[4-(methanesulfonamido)phenyl]propyl]acetamide (PubChem CID 143299424) has the molecular formula C19H23FN2O4S and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methoxy]-N-[3-[4-(methanesulfonamido)phenyl]propyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methoxy]-N-[3-[4-(methanesulfonamido)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 143299424 |
| Molecular Formula | C19H23FN2O4S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-[(4-fluorophenyl)methoxy]-N-[3-[4-(methanesulfonamido)phenyl]propyl]acetamide |
| SMILES | CS(=O)(=O)Nc1ccc(CCCNC(=O)COCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H23FN2O4S/c1-27(24,25)22-18-10-6-15(7-11-18)3-2-12-21-19(23)14-26-13-16-4-8-17(20)9-5-16/h4-11,22H,2-3,12-14H2,1H3,(H,21,23) |
| InChIKey | DVLPKQCBHJUBLA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|