C14H25NO2S — CID 143299467
N-[(2E,4E)-2,5-dimethylhepta-2,4-dienyl]-2-(3-hydroxypropylsulfanyl)acetamide (PubChem CID 143299467) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is N-[(2E,4E)-2,5-dimethylhepta-2,4-dienyl]-2-(3-hydroxypropylsulfanyl)acetamide.
| Compound Name | N-[(2E,4E)-2,5-dimethylhepta-2,4-dienyl]-2-(3-hydroxypropylsulfanyl)acetamide |
|---|---|
| PubChem CID | 143299467 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N-[(2E,4E)-2,5-dimethylhepta-2,4-dienyl]-2-(3-hydroxypropylsulfanyl)acetamide |
| SMILES | CC/C(C)=C/C=C(\C)CNC(=O)CSCCCO |
| InChI | InChI=1S/C14H25NO2S/c1-4-12(2)6-7-13(3)10-15-14(17)11-18-9-5-8-16/h6-7,16H,4-5,8-11H2,1-3H3,(H,15,17)/b12-6+,13-7+ |
| InChIKey | JAXUHSNJRKGMJW-PWHKKFIBSA-N |
| XLogP | 2.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|