About 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile
2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile (PubChem CID 143299667) has the molecular formula C15H31N5O2
and a molecular weight of 313.45 g/mol. Its IUPAC name is 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile.
Molecular Properties
| Compound Name | 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile |
| PubChem CID | 143299667 |
| Molecular Formula | C15H31N5O2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile |
| SMILES | CCC#N.CCNC(=O)C(NC(=O)C(C)NCCN)C(C)C |
| InChI | InChI=1S/C12H26N4O2.C3H5N/c1-5-14-12(18)10(8(2)3)16-11(17)9(4)15-7-6-13;1-2-3-4/h8-10,15H,5-7,13H2,1-4H3,(H,14,18)(H,16,17);2H2,1H3 |
| InChIKey | KQSFZNSMXTZTQG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile?
The IUPAC name of 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile (CID 143299667) is 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile.
What is the SMILES notation for 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile?
The canonical SMILES for 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile is CCC#N.CCNC(=O)C(NC(=O)C(C)NCCN)C(C)C.
What is the InChIKey of 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile?
The InChIKey is KQSFZNSMXTZTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N4O2.C3H5N/c1-5-14-12(18)10(8(2)3)16-11(17)9(4)15-7-6-13;1-2-3-4/h8-10,15H,5-7,13H2,1-4H3,(H,14,18)(H,16,17);2H2,1H3.
What are the key properties of 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile?
2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile has a molecular weight of 313.45 g/mol, XLogP of 0.12, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-aminoethylamino)propanoylamino]-N-ethyl-3-methylbutanamide;propanenitrile is sourced from PubChem (CID 143299667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).