C14H27NO — CID 143299990
4-(2,5-dimethyloct-5-enyl)morpholine (PubChem CID 143299990) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 4-(2,5-dimethyloct-5-enyl)morpholine.
| Compound Name | 4-(2,5-dimethyloct-5-enyl)morpholine |
|---|---|
| PubChem CID | 143299990 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 4-(2,5-dimethyloct-5-enyl)morpholine |
| SMILES | CCC=C(C)CCC(C)CN1CCOCC1 |
| InChI | InChI=1S/C14H27NO/c1-4-5-13(2)6-7-14(3)12-15-8-10-16-11-9-15/h5,14H,4,6-12H2,1-3H3 |
| InChIKey | ADMAJXKSRQIUIP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|