C23H31FN4O3 — CID 143300395
N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-3-hydroxy-8-methyl-4-oxo-9,9-dipropyl-6,7-dihydropyrazino[1,2-a]pyrimidine-2-carboxamide (PubChem CID 143300395) has the molecular formula C23H31FN4O3 and a molecular weight of 430.52 g/mol. Its IUPAC name is N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-3-hydroxy-8-methyl-4-oxo-9,9-dipropyl-6,7-dihydropyrazino[1,2-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-3-hydroxy-8-methyl-4-oxo-9,9-dipropyl-6,7-dihydropyrazino[1,2-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 143300395 |
| Molecular Formula | C23H31FN4O3 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-3-hydroxy-8-methyl-4-oxo-9,9-dipropyl-6,7-dihydropyrazino[1,2-a]pyrimidine-2-carboxamide |
| SMILES | CCCC1(CCC)c2nc(C(=O)NCC3=CCC=C(F)C=C3)c(O)c(=O)n2CCN1C |
| InChI | InChI=1S/C23H31FN4O3/c1-4-11-23(12-5-2)22-26-18(19(29)21(31)28(22)14-13-27(23)3)20(30)25-15-16-7-6-8-17(24)10-9-16/h7-10,29H,4-6,11-15H2,1-3H3,(H,25,30) |
| InChIKey | HVGNFPJUUWNIDI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |