C7H12N2O — CID 14330063
(NE)-N-[1-(1,2,3,6-tetrahydropyridin-4-yl)ethylidene]hydroxylamine (PubChem CID 14330063) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (NE)-N-[1-(1,2,3,6-tetrahydropyridin-4-yl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(1,2,3,6-tetrahydropyridin-4-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 14330063 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (NE)-N-[1-(1,2,3,6-tetrahydropyridin-4-yl)ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)C1=CCNCC1 |
| InChI | InChI=1S/C7H12N2O/c1-6(9-10)7-2-4-8-5-3-7/h2,8,10H,3-5H2,1H3/b9-6+ |
| InChIKey | SAUUZKORNGTHGG-RMKNXTFCSA-N |
| XLogP | 0.76 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|