C54H54Br2N6O4 — CID 14330082
methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(2-quinolin-1-ium-1-ylethyl)-22,23-dihydroporphyrin-2-yl]propanoate dibromide (PubChem CID 14330082) has the molecular formula C54H54Br2N6O4 and a molecular weight of 1010.87 g/mol. Its IUPAC name is methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(2-quinolin-1-ium-1-ylethyl)-22,23-dihydroporphyrin-2-yl]propanoate dibromide.
| Compound Name | methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(2-quinolin-1-ium-1-ylethyl)-22,23-dihydroporphyrin-2-yl]propanoate dibromide |
|---|---|
| PubChem CID | 14330082 |
| Molecular Formula | C54H54Br2N6O4 |
| Molecular Weight | 1010.87 g/mol |
| Exact Mass | 1008.26 |
| IUPAC Name | methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(2-quinolin-1-ium-1-ylethyl)-22,23-dihydroporphyrin-2-yl]propanoate dibromide |
| SMILES | COC(=O)CCC1=C(C)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(CCC(=O)OC)=C5C)c(CC[n+]1cccc2ccccc21)c4C)c(CC[n+]1cccc2ccccc21)c3C.[Br-].[Br-] |
| InChI | InChI=1S/C54H54N6O4.2BrH/c1-33-39(19-21-53(61)63-5)49-32-50-40(20-22-54(62)64-6)34(2)45(58-50)30-48-42(24-28-60-26-12-16-38-14-8-10-18-52(38)60)36(4)46(57-48)31-47-41(35(3)44(55-47)29-43(33)56-49)23-27-59-25-11-15-37-13-7-9-17-51(37)59;;/h7-18,25-26,29-32,55,57H,19-24,27-28H2,1-6H3;2*1H/q+2;;/p-2/b43-29-,44-29-,45-30-,46-31-,47-31-,48-30-,49-32-,50-32-;; |
| InChIKey | ZSZRCKWAKLLQJC-JYTQZRITSA-L |
| XLogP | 4.07 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1010.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|