C17H14ClFN2O2 — CID 14330090
2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5,6,7,8-tetrahydrophthalazin-1-one (PubChem CID 14330090) has the molecular formula C17H14ClFN2O2 and a molecular weight of 332.76 g/mol. Its IUPAC name is 2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5,6,7,8-tetrahydrophthalazin-1-one.
| Compound Name | 2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5,6,7,8-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 14330090 |
| Molecular Formula | C17H14ClFN2O2 |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5,6,7,8-tetrahydrophthalazin-1-one |
| SMILES | C#CCOc1cc(-n2ncc3c(c2=O)CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C17H14ClFN2O2/c1-2-7-23-16-9-15(14(19)8-13(16)18)21-17(22)12-6-4-3-5-11(12)10-20-21/h1,8-10H,3-7H2 |
| InChIKey | CJOSYNIHPOWVSY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|