C23H23N3 — CID 143301043
2-[(2Z,4Z)-hepta-2,4-dienyl]-4-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-6-phenyl-1,3,5-triazine (PubChem CID 143301043) has the molecular formula C23H23N3 and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-[(2Z,4Z)-hepta-2,4-dienyl]-4-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[(2Z,4Z)-hepta-2,4-dienyl]-4-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 143301043 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[(2Z,4Z)-hepta-2,4-dienyl]-4-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-6-phenyl-1,3,5-triazine |
| SMILES | C#C/C=C\C=C/Cc1nc(C/C=C\C=C/CC)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H23N3/c1-3-5-7-9-14-18-21-24-22(19-15-10-8-6-4-2)26-23(25-21)20-16-12-11-13-17-20/h1,5-17H,4,18-19H2,2H3/b7-5-,8-6-,14-9-,15-10- |
| InChIKey | AFFPDDRIGAJANK-XCQIGSCBSA-N |
| XLogP | 4.89 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|