C12H18N6 — CID 143301116
N,N'-diamino-3-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-1H-pyrazole-5-carboximidamide (PubChem CID 143301116) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is N,N'-diamino-3-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-1H-pyrazole-5-carboximidamide.
| Compound Name | N,N'-diamino-3-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-1H-pyrazole-5-carboximidamide |
|---|---|
| PubChem CID | 143301116 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N,N'-diamino-3-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]-1H-pyrazole-5-carboximidamide |
| SMILES | C/C=C\C(=C/C=C/C)c1cc(/C(=N/N)NN)[nH]n1 |
| InChI | InChI=1S/C12H18N6/c1-3-5-7-9(6-4-2)10-8-11(18-17-10)12(15-13)16-14/h3-8H,13-14H2,1-2H3,(H,15,16)(H,17,18)/b5-3+,6-4-,9-7+ |
| InChIKey | KQGWPKPNSFMJOM-ZIPWMNKMSA-N |
| XLogP | 1.03 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|