C14H16N4OS — CID 143301138
3-[3-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-1H-pyrazol-5-yl]-4H-1,2,4-thiadiazol-5-one (PubChem CID 143301138) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 3-[3-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-1H-pyrazol-5-yl]-4H-1,2,4-thiadiazol-5-one.
| Compound Name | 3-[3-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-1H-pyrazol-5-yl]-4H-1,2,4-thiadiazol-5-one |
|---|---|
| PubChem CID | 143301138 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-[3-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-1H-pyrazol-5-yl]-4H-1,2,4-thiadiazol-5-one |
| SMILES | C/C=C\C(=C/C=C/CC)c1cc(-c2nsc(=O)[nH]2)[nH]n1 |
| InChI | InChI=1S/C14H16N4OS/c1-3-5-6-8-10(7-4-2)11-9-12(17-16-11)13-15-14(19)20-18-13/h4-9H,3H2,1-2H3,(H,16,17)(H,15,18,19)/b6-5+,7-4-,10-8+ |
| InChIKey | YOWXMBXQLPRYSX-VBIDDDQESA-N |
| XLogP | 3.15 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|