About [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium
[(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium (PubChem CID 143301220) has the molecular formula C9H13N2+
and a molecular weight of 149.22 g/mol. Its IUPAC name is [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium.
Molecular Properties
| Compound Name | [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium |
| PubChem CID | 143301220 |
| Molecular Formula | C9H13N2+ |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium |
| SMILES | C=[N+](C)/C=C\C=C1/CC=CN1 |
| InChI | InChI=1S/C9H13N2/c1-11(2)8-4-6-9-5-3-7-10-9/h3-4,6-8,10H,1,5H2,2H3/q+1/b8-4-,9-6+ |
| InChIKey | DHYARRXFYSHWNS-NDFHIPMUSA-N |
| XLogP | 1.23 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium?
The IUPAC name of [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium (CID 143301220) is [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium.
What is the SMILES notation for [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium?
The canonical SMILES for [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium is C=[N+](C)/C=C\C=C1/CC=CN1.
What is the InChIKey of [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium?
The InChIKey is DHYARRXFYSHWNS-NDFHIPMUSA-N. The full InChI is InChI=1S/C9H13N2/c1-11(2)8-4-6-9-5-3-7-10-9/h3-4,6-8,10H,1,5H2,2H3/q+1/b8-4-,9-6+.
What are the key properties of [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium?
[(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium has a molecular weight of 149.22 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,3E)-3-(1,3-dihydropyrrol-2-ylidene)prop-1-enyl]-methyl-methylideneazanium is sourced from PubChem (CID 143301220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).